C9H13N5OS — CID 72919531
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-methyl-1,3,4-oxadiazol-2-amine (PubChem CID 72919531) has the molecular formula C9H13N5OS and a molecular weight of 239.30 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-methyl-1,3,4-oxadiazol-2-amine.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-methyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 72919531 |
| Molecular Formula | C9H13N5OS |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-methyl-1,3,4-oxadiazol-2-amine |
| SMILES | Cc1nnc(NCCCc2csc(N)n2)o1 |
| InChI | InChI=1S/C9H13N5OS/c1-6-13-14-9(15-6)11-4-2-3-7-5-16-8(10)12-7/h5H,2-4H2,1H3,(H2,10,12)(H,11,14) |
| InChIKey | PBTYSAYGLXZVPU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|