About 3-(2-amino-4-fluoro-1,3-benzothiazol-6-yl)-N,N-dimethylbenzamide
3-(2-amino-4-fluoro-1,3-benzothiazol-6-yl)-N,N-dimethylbenzamide (PubChem CID 72919610) has the molecular formula C16H14FN3OS
and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-(2-amino-4-fluoro-1,3-benzothiazol-6-yl)-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-(2-amino-4-fluoro-1,3-benzothiazol-6-yl)-N,N-dimethylbenzamide |
| PubChem CID | 72919610 |
| Molecular Formula | C16H14FN3OS |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-(2-amino-4-fluoro-1,3-benzothiazol-6-yl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(-c2cc(F)c3nc(N)sc3c2)c1 |
| InChI | InChI=1S/C16H14FN3OS/c1-20(2)15(21)10-5-3-4-9(6-10)11-7-12(17)14-13(8-11)22-16(18)19-14/h3-8H,1-2H3,(H2,18,19) |
| InChIKey | YRUWLWYNKXXPIK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-amino-4-fluoro-1,3-benzothiazol-6-yl)-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-4-fluoro-1,3-benzothiazol-6-yl)-N,N-dimethylbenzamide?
The IUPAC name of 3-(2-amino-4-fluoro-1,3-benzothiazol-6-yl)-N,N-dimethylbenzamide (CID 72919610) is 3-(2-amino-4-fluoro-1,3-benzothiazol-6-yl)-N,N-dimethylbenzamide.
What is the SMILES notation for 3-(2-amino-4-fluoro-1,3-benzothiazol-6-yl)-N,N-dimethylbenzamide?
The canonical SMILES for 3-(2-amino-4-fluoro-1,3-benzothiazol-6-yl)-N,N-dimethylbenzamide is CN(C)C(=O)c1cccc(-c2cc(F)c3nc(N)sc3c2)c1.
What is the InChIKey of 3-(2-amino-4-fluoro-1,3-benzothiazol-6-yl)-N,N-dimethylbenzamide?
The InChIKey is YRUWLWYNKXXPIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FN3OS/c1-20(2)15(21)10-5-3-4-9(6-10)11-7-12(17)14-13(8-11)22-16(18)19-14/h3-8H,1-2H3,(H2,18,19).
What are the key properties of 3-(2-amino-4-fluoro-1,3-benzothiazol-6-yl)-N,N-dimethylbenzamide?
3-(2-amino-4-fluoro-1,3-benzothiazol-6-yl)-N,N-dimethylbenzamide has a molecular weight of 315.37 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-4-fluoro-1,3-benzothiazol-6-yl)-N,N-dimethylbenzamide is sourced from PubChem (CID 72919610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).