C20H21F2NO3 — CID 72919745
[(3aS,9bS)-2-[(2,3-difluorophenyl)methyl]-7-methoxy-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 72919745) has the molecular formula C20H21F2NO3 and a molecular weight of 361.39 g/mol. Its IUPAC name is [(3aS,9bS)-2-[(2,3-difluorophenyl)methyl]-7-methoxy-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aS,9bS)-2-[(2,3-difluorophenyl)methyl]-7-methoxy-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 72919745 |
| Molecular Formula | C20H21F2NO3 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | [(3aS,9bS)-2-[(2,3-difluorophenyl)methyl]-7-methoxy-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | COc1ccc2c(c1)OC[C@]1(CO)CN(Cc3cccc(F)c3F)C[C@H]21 |
| InChI | InChI=1S/C20H21F2NO3/c1-25-14-5-6-15-16-9-23(8-13-3-2-4-17(21)19(13)22)10-20(16,11-24)12-26-18(15)7-14/h2-7,16,24H,8-12H2,1H3/t16-,20-/m1/s1 |
| InChIKey | GHUTXQCPVDARGK-OXQOHEQNSA-N |
| XLogP | 2.94 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |