C19H26N4O2S — CID 72919949
trans-(1S,3R)-1-N-(2,1,3-benzothiadiazol-5-ylmethyl)-3-N,3-N,1,2,2-pentamethylcyclopentane-1,3-dicarboxamide (PubChem CID 72919949) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is trans-(1S,3R)-1-N-(2,1,3-benzothiadiazol-5-ylmethyl)-3-N,3-N,1,2,2-pentamethylcyclopentane-1,3-dicarboxamide.
| Compound Name | trans-(1S,3R)-1-N-(2,1,3-benzothiadiazol-5-ylmethyl)-3-N,3-N,1,2,2-pentamethylcyclopentane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 72919949 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | trans-(1S,3R)-1-N-(2,1,3-benzothiadiazol-5-ylmethyl)-3-N,3-N,1,2,2-pentamethylcyclopentane-1,3-dicarboxamide |
| SMILES | CN(C)C(=O)[C@@H]1CC[C@](C)(C(=O)NCc2ccc3nsnc3c2)C1(C)C |
| InChI | InChI=1S/C19H26N4O2S/c1-18(2)13(16(24)23(4)5)8-9-19(18,3)17(25)20-11-12-6-7-14-15(10-12)22-26-21-14/h6-7,10,13H,8-9,11H2,1-5H3,(H,20,25)/t13-,19+/m0/s1 |
| InChIKey | FDPQTYDOFWIQTM-ORAYPTAESA-N |
| XLogP | 2.84 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |