C22H24N6 — CID 72920155
6-[4-[2-(1-phenylpyrazol-4-yl)ethylamino]piperidin-1-yl]pyridine-3-carbonitrile (PubChem CID 72920155) has the molecular formula C22H24N6 and a molecular weight of 372.48 g/mol. Its IUPAC name is 6-[4-[2-(1-phenylpyrazol-4-yl)ethylamino]piperidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[2-(1-phenylpyrazol-4-yl)ethylamino]piperidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 72920155 |
| Molecular Formula | C22H24N6 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 6-[4-[2-(1-phenylpyrazol-4-yl)ethylamino]piperidin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCC(NCCc3cnn(-c4ccccc4)c3)CC2)nc1 |
| InChI | InChI=1S/C22H24N6/c23-14-18-6-7-22(25-15-18)27-12-9-20(10-13-27)24-11-8-19-16-26-28(17-19)21-4-2-1-3-5-21/h1-7,15-17,20,24H,8-13H2 |
| InChIKey | QIMROEKEHVNRCC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 69.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |