C18H28N4O2S — CID 72920790
(3R,5S)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-5-(pyrrolidine-1-carbonyl)piperidine-3-carboxamide (PubChem CID 72920790) has the molecular formula C18H28N4O2S and a molecular weight of 364.52 g/mol. Its IUPAC name is (3R,5S)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-5-(pyrrolidine-1-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3R,5S)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-5-(pyrrolidine-1-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 72920790 |
| Molecular Formula | C18H28N4O2S |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (3R,5S)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-5-(pyrrolidine-1-carbonyl)piperidine-3-carboxamide |
| SMILES | Cc1csc(CCCNC(=O)[C@H]2CNC[C@@H](C(=O)N3CCCC3)C2)n1 |
| InChI | InChI=1S/C18H28N4O2S/c1-13-12-25-16(21-13)5-4-6-20-17(23)14-9-15(11-19-10-14)18(24)22-7-2-3-8-22/h12,14-15,19H,2-11H2,1H3,(H,20,23)/t14-,15+/m1/s1 |
| InChIKey | HSBQMWWXGTXGDS-CABCVRRESA-N |
| XLogP | 1.35 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|