C14H13N3OS — CID 72920970
6-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1,6-naphthyridin-5-one (PubChem CID 72920970) has the molecular formula C14H13N3OS and a molecular weight of 271.34 g/mol. Its IUPAC name is 6-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1,6-naphthyridin-5-one.
| Compound Name | 6-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 72920970 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 6-[(2-ethyl-1,3-thiazol-4-yl)methyl]-1,6-naphthyridin-5-one |
| SMILES | CCc1nc(Cn2ccc3ncccc3c2=O)cs1 |
| InChI | InChI=1S/C14H13N3OS/c1-2-13-16-10(9-19-13)8-17-7-5-12-11(14(17)18)4-3-6-15-12/h3-7,9H,2,8H2,1H3 |
| InChIKey | NTDGIMIRZWTDRD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |