About Methyl 4-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)piperazine-1-carboxylate
Methyl 4-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)piperazine-1-carboxylate (PubChem CID 72921383) has the molecular formula C15H19N5O2
and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl 4-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | Methyl 4-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)piperazine-1-carboxylate |
| PubChem CID | 72921383 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | methyl 4-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)piperazine-1-carboxylate |
| SMILES | CC1=CC(=NC2=C1C(=NC=N2)N3CCN(CC3)C(=O)OC)C |
| InChI | InChI=1S/C15H19N5O2/c1-10-8-11(2)18-13-12(10)14(17-9-16-13)19-4-6-20(7-5-19)15(21)22-3/h8-9H,4-7H2,1-3H3 |
| InChIKey | XWGNHKVVQLEYJQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 71.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | 399 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze Methyl 4-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Methyl 4-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)piperazine-1-carboxylate?
The IUPAC name of Methyl 4-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)piperazine-1-carboxylate (CID 72921383) is methyl 4-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)piperazine-1-carboxylate.
What is the SMILES notation for Methyl 4-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)piperazine-1-carboxylate?
The canonical SMILES for Methyl 4-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)piperazine-1-carboxylate is CC1=CC(=NC2=C1C(=NC=N2)N3CCN(CC3)C(=O)OC)C.
What is the InChIKey of Methyl 4-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)piperazine-1-carboxylate?
The InChIKey is XWGNHKVVQLEYJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O2/c1-10-8-11(2)18-13-12(10)14(17-9-16-13)19-4-6-20(7-5-19)15(21)22-3/h8-9H,4-7H2,1-3H3.
What are the key properties of Methyl 4-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)piperazine-1-carboxylate?
Methyl 4-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)piperazine-1-carboxylate has a molecular weight of 301.34 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Methyl 4-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)piperazine-1-carboxylate is sourced from PubChem (CID 72921383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).