C18H22N4O4 — CID 72921684
(3aR,9bR)-2-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-6-methoxy-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72921684) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is (3aR,9bR)-2-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-6-methoxy-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,9bR)-2-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-6-methoxy-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72921684 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (3aR,9bR)-2-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-6-methoxy-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | COc1cccc2c1OC[C@]1(C(=O)O)CN(Cc3nc(C)nn3C)C[C@H]21 |
| InChI | InChI=1S/C18H22N4O4/c1-11-19-15(21(2)20-11)8-22-7-13-12-5-4-6-14(25-3)16(12)26-10-18(13,9-22)17(23)24/h4-6,13H,7-10H2,1-3H3,(H,23,24)/t13-,18-/m1/s1 |
| InChIKey | IQPXXBOCXIGCSV-FZKQIMNGSA-N |
| XLogP | 1.19 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |