C17H27N3O — CID 72921867
(1S,5R)-3-(3-methoxypropyl)-6-(pyridin-2-ylmethyl)-3,6-diazabicyclo[3.2.2]nonane (PubChem CID 72921867) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is (1S,5R)-3-(3-methoxypropyl)-6-(pyridin-2-ylmethyl)-3,6-diazabicyclo[3.2.2]nonane.
| Compound Name | (1S,5R)-3-(3-methoxypropyl)-6-(pyridin-2-ylmethyl)-3,6-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 72921867 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | (1S,5R)-3-(3-methoxypropyl)-6-(pyridin-2-ylmethyl)-3,6-diazabicyclo[3.2.2]nonane |
| SMILES | COCCCN1C[C@@H]2CC[C@H](C1)N(Cc1ccccn1)C2 |
| InChI | InChI=1S/C17H27N3O/c1-21-10-4-9-19-11-15-6-7-17(14-19)20(12-15)13-16-5-2-3-8-18-16/h2-3,5,8,15,17H,4,6-7,9-14H2,1H3/t15-,17+/m0/s1 |
| InChIKey | NFDACBWBZXPRTC-DOTOQJQBSA-N |
| XLogP | 2.01 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|