C21H29N3O2 — CID 72921968
2-[[(4aS,8aR)-4a-(hydroxymethyl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]methyl]-5,8-dimethyl-1H-quinolin-4-one (PubChem CID 72921968) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-[[(4aS,8aR)-4a-(hydroxymethyl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]methyl]-5,8-dimethyl-1H-quinolin-4-one.
| Compound Name | 2-[[(4aS,8aR)-4a-(hydroxymethyl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]methyl]-5,8-dimethyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 72921968 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 2-[[(4aS,8aR)-4a-(hydroxymethyl)-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]methyl]-5,8-dimethyl-1H-quinolin-4-one |
| SMILES | Cc1ccc(C)c2c(=O)cc(CN3CC[C@H]4NCCC[C@]4(CO)C3)[nH]c12 |
| InChI | InChI=1S/C21H29N3O2/c1-14-4-5-15(2)20-19(14)17(26)10-16(23-20)11-24-9-6-18-21(12-24,13-25)7-3-8-22-18/h4-5,10,18,22,25H,3,6-9,11-13H2,1-2H3,(H,23,26)/t18-,21-/m1/s1 |
| InChIKey | HAWHAPNOFKWYIB-WIYYLYMNSA-N |
| XLogP | 2.08 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |