C19H23FN2O3 — CID 729222
1-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-fluorophenyl)urea (PubChem CID 729222) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 729222 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-fluorophenyl)urea |
| SMILES | CCOc1ccc(CCNC(=O)Nc2ccc(F)cc2)cc1OCC |
| InChI | InChI=1S/C19H23FN2O3/c1-3-24-17-10-5-14(13-18(17)25-4-2)11-12-21-19(23)22-16-8-6-15(20)7-9-16/h5-10,13H,3-4,11-12H2,1-2H3,(H2,21,22,23) |
| InChIKey | HTOPQOJLIDLXJA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |