C18H26N6O — CID 72922280
3-[2-(cyclopropylmethyl)pyrazol-3-yl]-1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1-methylurea (PubChem CID 72922280) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is 3-[2-(cyclopropylmethyl)pyrazol-3-yl]-1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1-methylurea.
| Compound Name | 3-[2-(cyclopropylmethyl)pyrazol-3-yl]-1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1-methylurea |
|---|---|
| PubChem CID | 72922280 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 3-[2-(cyclopropylmethyl)pyrazol-3-yl]-1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1-methylurea |
| SMILES | CN(Cc1n[nH]c2c1CCCCC2)C(=O)Nc1ccnn1CC1CC1 |
| InChI | InChI=1S/C18H26N6O/c1-23(12-16-14-5-3-2-4-6-15(14)21-22-16)18(25)20-17-9-10-19-24(17)11-13-7-8-13/h9-10,13H,2-8,11-12H2,1H3,(H,20,25)(H,21,22) |
| InChIKey | HQVJZFUYGCRVEQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |