C11H15F3N2O2 — CID 72922471
2-(3,3,3-trifluoropropanoyl)-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 72922471) has the molecular formula C11H15F3N2O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is 2-(3,3,3-trifluoropropanoyl)-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | 2-(3,3,3-trifluoropropanoyl)-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 72922471 |
| Molecular Formula | C11H15F3N2O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-(3,3,3-trifluoropropanoyl)-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | O=C(CC(F)(F)F)N1CCC2(CCCNC2=O)C1 |
| InChI | InChI=1S/C11H15F3N2O2/c12-11(13,14)6-8(17)16-5-3-10(7-16)2-1-4-15-9(10)18/h1-7H2,(H,15,18) |
| InChIKey | UZTFLNCELVRBLZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |