C13H13FN6 — CID 72923478
5-fluoro-N-[3-(triazol-1-yl)propyl]quinazolin-4-amine (PubChem CID 72923478) has the molecular formula C13H13FN6 and a molecular weight of 272.29 g/mol. Its IUPAC name is 5-fluoro-N-[3-(triazol-1-yl)propyl]quinazolin-4-amine.
| Compound Name | 5-fluoro-N-[3-(triazol-1-yl)propyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 72923478 |
| Molecular Formula | C13H13FN6 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 5-fluoro-N-[3-(triazol-1-yl)propyl]quinazolin-4-amine |
| SMILES | Fc1cccc2ncnc(NCCCn3ccnn3)c12 |
| InChI | InChI=1S/C13H13FN6/c14-10-3-1-4-11-12(10)13(17-9-16-11)15-5-2-7-20-8-6-18-19-20/h1,3-4,6,8-9H,2,5,7H2,(H,15,16,17) |
| InChIKey | YVRVMZVULMTPTM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|