C19H23ClN2O4 — CID 72923826
(3aR,6aR)-5-(4-chlorobenzoyl)-2-(oxan-4-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72923826) has the molecular formula C19H23ClN2O4 and a molecular weight of 378.86 g/mol. Its IUPAC name is (3aR,6aR)-5-(4-chlorobenzoyl)-2-(oxan-4-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-(4-chlorobenzoyl)-2-(oxan-4-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72923826 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (3aR,6aR)-5-(4-chlorobenzoyl)-2-(oxan-4-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(c1ccc(Cl)cc1)N1C[C@H]2CN(C3CCOCC3)C[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C19H23ClN2O4/c20-15-3-1-13(2-4-15)17(23)22-10-14-9-21(16-5-7-26-8-6-16)11-19(14,12-22)18(24)25/h1-4,14,16H,5-12H2,(H,24,25)/t14-,19-/m1/s1 |
| InChIKey | CTWHFJSZERRCRS-AUUYWEPGSA-N |
| XLogP | 1.98 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |