About 1,3-dihydroimidazo[4,5-b]pyridine-2-thione
1,3-dihydroimidazo[4,5-b]pyridine-2-thione (PubChem CID 729246) has the molecular formula C6H5N3S
and a molecular weight of 151.19 g/mol. Its IUPAC name is 1,3-dihydroimidazo[4,5-b]pyridine-2-thione.
Molecular Properties
| Compound Name | 1,3-dihydroimidazo[4,5-b]pyridine-2-thione |
| PubChem CID | 729246 |
| Molecular Formula | C6H5N3S |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | 1,3-dihydroimidazo[4,5-b]pyridine-2-thione |
| SMILES | S=c1[nH]c2cccnc2[nH]1 |
| InChI | InChI=1S/C6H5N3S/c10-6-8-4-2-1-3-7-5(4)9-6/h1-3H,(H2,7,8,9,10) |
| InChIKey | ZLYRPVTXHARSPL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dihydroimidazo[4,5-b]pyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydroimidazo[4,5-b]pyridine-2-thione?
The IUPAC name of 1,3-dihydroimidazo[4,5-b]pyridine-2-thione (CID 729246) is 1,3-dihydroimidazo[4,5-b]pyridine-2-thione.
What is the SMILES notation for 1,3-dihydroimidazo[4,5-b]pyridine-2-thione?
The canonical SMILES for 1,3-dihydroimidazo[4,5-b]pyridine-2-thione is S=c1[nH]c2cccnc2[nH]1.
What is the InChIKey of 1,3-dihydroimidazo[4,5-b]pyridine-2-thione?
The InChIKey is ZLYRPVTXHARSPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3S/c10-6-8-4-2-1-3-7-5(4)9-6/h1-3H,(H2,7,8,9,10).
What are the key properties of 1,3-dihydroimidazo[4,5-b]pyridine-2-thione?
1,3-dihydroimidazo[4,5-b]pyridine-2-thione has a molecular weight of 151.19 g/mol, XLogP of 1.62, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydroimidazo[4,5-b]pyridine-2-thione is sourced from PubChem (CID 729246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).