C14H21N5O3S — CID 72924998
[(4aS,7aR)-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclopropylmethanone (PubChem CID 72924998) has the molecular formula C14H21N5O3S and a molecular weight of 339.42 g/mol. Its IUPAC name is [(4aS,7aR)-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclopropylmethanone.
| Compound Name | [(4aS,7aR)-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 72924998 |
| Molecular Formula | C14H21N5O3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | [(4aS,7aR)-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclopropylmethanone |
| SMILES | Cn1cnnc1CN1CCN(C(=O)C2CC2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C14H21N5O3S/c1-17-9-15-16-13(17)6-18-4-5-19(14(20)10-2-3-10)12-8-23(21,22)7-11(12)18/h9-12H,2-8H2,1H3/t11-,12+/m0/s1 |
| InChIKey | TXXHULLRCFOEDA-NWDGAFQWSA-N |
| XLogP | -0.97 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |