C20H23F2N3O2 — CID 72925043
(2,4-difluorophenyl)-[(1S,5R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3,6-diazabicyclo[3.2.2]nonan-6-yl]methanone (PubChem CID 72925043) has the molecular formula C20H23F2N3O2 and a molecular weight of 375.42 g/mol. Its IUPAC name is (2,4-difluorophenyl)-[(1S,5R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3,6-diazabicyclo[3.2.2]nonan-6-yl]methanone.
| Compound Name | (2,4-difluorophenyl)-[(1S,5R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3,6-diazabicyclo[3.2.2]nonan-6-yl]methanone |
|---|---|
| PubChem CID | 72925043 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (2,4-difluorophenyl)-[(1S,5R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3,6-diazabicyclo[3.2.2]nonan-6-yl]methanone |
| SMILES | Cc1noc(C)c1CN1C[C@@H]2CC[C@H](C1)N(C(=O)c1ccc(F)cc1F)C2 |
| InChI | InChI=1S/C20H23F2N3O2/c1-12-18(13(2)27-23-12)11-24-8-14-3-5-16(10-24)25(9-14)20(26)17-6-4-15(21)7-19(17)22/h4,6-7,14,16H,3,5,8-11H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | MZTVPJSRYWKLEZ-GOEBONIOSA-N |
| XLogP | 3.31 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |