C15H17N5O2 — CID 72925259
8-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 72925259) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 8-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 72925259 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 8-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | O=C1CC2(CCCC2)CC(=O)N1Cc1nc2ncccn2n1 |
| InChI | InChI=1S/C15H17N5O2/c21-12-8-15(4-1-2-5-15)9-13(22)19(12)10-11-17-14-16-6-3-7-20(14)18-11/h3,6-7H,1-2,4-5,8-10H2 |
| InChIKey | RORGRMLFAKGYNY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 80.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|