About [6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-pyridinyl]methanamine
[6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-pyridinyl]methanamine (PubChem CID 72925262) has the molecular formula C17H20N2O2
and a molecular weight of 284.36 g/mol. Its IUPAC name is [6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-pyridinyl]methanamine |
| PubChem CID | 72925262 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | [6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-pyridinyl]methanamine |
| SMILES | COc1ccc2c(c1)OCC(Cc1ccc(CN)cn1)C2 |
| InChI | InChI=1S/C17H20N2O2/c1-20-16-5-3-14-6-13(11-21-17(14)8-16)7-15-4-2-12(9-18)10-19-15/h2-5,8,10,13H,6-7,9,11,18H2,1H3 |
| InChIKey | NBHKBHBIAGKSHL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-pyridinyl]methanamine?
The IUPAC name of [6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-pyridinyl]methanamine (CID 72925262) is [6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-pyridinyl]methanamine.
What is the SMILES notation for [6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-pyridinyl]methanamine?
The canonical SMILES for [6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-pyridinyl]methanamine is COc1ccc2c(c1)OCC(Cc1ccc(CN)cn1)C2.
What is the InChIKey of [6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-pyridinyl]methanamine?
The InChIKey is NBHKBHBIAGKSHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O2/c1-20-16-5-3-14-6-13(11-21-17(14)8-16)7-15-4-2-12(9-18)10-19-15/h2-5,8,10,13H,6-7,9,11,18H2,1H3.
What are the key properties of [6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-pyridinyl]methanamine?
[6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-pyridinyl]methanamine has a molecular weight of 284.36 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-3-pyridinyl]methanamine is sourced from PubChem (CID 72925262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).