About phenyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate
phenyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 729253) has the molecular formula C17H13NO3
and a molecular weight of 279.30 g/mol. Its IUPAC name is phenyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | phenyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| PubChem CID | 729253 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | phenyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C17H13NO3/c1-12-15(17(19)20-14-10-6-3-7-11-14)16(18-21-12)13-8-4-2-5-9-13/h2-11H,1H3 |
| InChIKey | BMLTWXNHYACLOI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
The IUPAC name of phenyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (CID 729253) is phenyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
What is the SMILES notation for phenyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
The canonical SMILES for phenyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate is Cc1onc(-c2ccccc2)c1C(=O)Oc1ccccc1.
What is the InChIKey of phenyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
The InChIKey is BMLTWXNHYACLOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO3/c1-12-15(17(19)20-14-10-6-3-7-11-14)16(18-21-12)13-8-4-2-5-9-13/h2-11H,1H3.
What are the key properties of phenyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
phenyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate has a molecular weight of 279.30 g/mol, XLogP of 3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 729253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).