About 5-[(3R,4S)-3-amino-4-propylpyrrolidine-1-carbonyl]-1H-pyrazin-2-one
5-[(3R,4S)-3-amino-4-propylpyrrolidine-1-carbonyl]-1H-pyrazin-2-one (PubChem CID 72925848) has the molecular formula C12H18N4O2
and a molecular weight of 250.30 g/mol. Its IUPAC name is 5-[(3R,4S)-3-amino-4-propylpyrrolidine-1-carbonyl]-1H-pyrazin-2-one.
Molecular Properties
| Compound Name | 5-[(3R,4S)-3-amino-4-propylpyrrolidine-1-carbonyl]-1H-pyrazin-2-one |
| PubChem CID | 72925848 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 5-[(3R,4S)-3-amino-4-propylpyrrolidine-1-carbonyl]-1H-pyrazin-2-one |
| SMILES | CCC[C@H]1CN(C(=O)c2c[nH]c(=O)cn2)C[C@@H]1N |
| InChI | InChI=1S/C12H18N4O2/c1-2-3-8-6-16(7-9(8)13)12(18)10-4-15-11(17)5-14-10/h4-5,8-9H,2-3,6-7,13H2,1H3,(H,15,17)/t8-,9-/m0/s1 |
| InChIKey | JKIYMBVULDLVQG-IUCAKERBSA-N |
| XLogP | -0.03 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3R,4S)-3-amino-4-propylpyrrolidine-1-carbonyl]-1H-pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3R,4S)-3-amino-4-propylpyrrolidine-1-carbonyl]-1H-pyrazin-2-one?
The IUPAC name of 5-[(3R,4S)-3-amino-4-propylpyrrolidine-1-carbonyl]-1H-pyrazin-2-one (CID 72925848) is 5-[(3R,4S)-3-amino-4-propylpyrrolidine-1-carbonyl]-1H-pyrazin-2-one.
What is the SMILES notation for 5-[(3R,4S)-3-amino-4-propylpyrrolidine-1-carbonyl]-1H-pyrazin-2-one?
The canonical SMILES for 5-[(3R,4S)-3-amino-4-propylpyrrolidine-1-carbonyl]-1H-pyrazin-2-one is CCC[C@H]1CN(C(=O)c2c[nH]c(=O)cn2)C[C@@H]1N.
What is the InChIKey of 5-[(3R,4S)-3-amino-4-propylpyrrolidine-1-carbonyl]-1H-pyrazin-2-one?
The InChIKey is JKIYMBVULDLVQG-IUCAKERBSA-N. The full InChI is InChI=1S/C12H18N4O2/c1-2-3-8-6-16(7-9(8)13)12(18)10-4-15-11(17)5-14-10/h4-5,8-9H,2-3,6-7,13H2,1H3,(H,15,17)/t8-,9-/m0/s1.
What are the key properties of 5-[(3R,4S)-3-amino-4-propylpyrrolidine-1-carbonyl]-1H-pyrazin-2-one?
5-[(3R,4S)-3-amino-4-propylpyrrolidine-1-carbonyl]-1H-pyrazin-2-one has a molecular weight of 250.30 g/mol, XLogP of -0.03, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3R,4S)-3-amino-4-propylpyrrolidine-1-carbonyl]-1H-pyrazin-2-one is sourced from PubChem (CID 72925848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).