C14H22FN5O — CID 72926021
N-[[1-[4-(dimethylamino)-5-fluoropyrimidin-2-yl]piperidin-4-yl]methyl]acetamide (PubChem CID 72926021) has the molecular formula C14H22FN5O and a molecular weight of 295.36 g/mol. Its IUPAC name is N-[[1-[4-(dimethylamino)-5-fluoropyrimidin-2-yl]piperidin-4-yl]methyl]acetamide.
| Compound Name | N-[[1-[4-(dimethylamino)-5-fluoropyrimidin-2-yl]piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 72926021 |
| Molecular Formula | C14H22FN5O |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N-[[1-[4-(dimethylamino)-5-fluoropyrimidin-2-yl]piperidin-4-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCN(c2ncc(F)c(N(C)C)n2)CC1 |
| InChI | InChI=1S/C14H22FN5O/c1-10(21)16-8-11-4-6-20(7-5-11)14-17-9-12(15)13(18-14)19(2)3/h9,11H,4-8H2,1-3H3,(H,16,21) |
| InChIKey | OCTRODZPIHZOOY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |