C22H24FN3O — CID 72926146
[4-[[1-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]pyrrolidin-3-yl]methyl]phenyl]methanol (PubChem CID 72926146) has the molecular formula C22H24FN3O and a molecular weight of 365.45 g/mol. Its IUPAC name is [4-[[1-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]pyrrolidin-3-yl]methyl]phenyl]methanol.
| Compound Name | [4-[[1-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]pyrrolidin-3-yl]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 72926146 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | [4-[[1-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]pyrrolidin-3-yl]methyl]phenyl]methanol |
| SMILES | OCc1ccc(CC2CCN(Cc3cn[nH]c3-c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C22H24FN3O/c23-21-7-5-19(6-8-21)22-20(12-24-25-22)14-26-10-9-18(13-26)11-16-1-3-17(15-27)4-2-16/h1-8,12,18,27H,9-11,13-15H2,(H,24,25) |
| InChIKey | YDDZBARJRLBLRK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |