C19H28N4O3 — CID 72926429
(3aR,6aR)-2-(oxan-4-yl)-5-(5-propylpyrimidin-4-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72926429) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is (3aR,6aR)-2-(oxan-4-yl)-5-(5-propylpyrimidin-4-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-2-(oxan-4-yl)-5-(5-propylpyrimidin-4-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72926429 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | (3aR,6aR)-2-(oxan-4-yl)-5-(5-propylpyrimidin-4-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CCCc1cncnc1N1C[C@H]2CN(C3CCOCC3)C[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C19H28N4O3/c1-2-3-14-8-20-13-21-17(14)23-10-15-9-22(16-4-6-26-7-5-16)11-19(15,12-23)18(24)25/h8,13,15-16H,2-7,9-12H2,1H3,(H,24,25)/t15-,19-/m1/s1 |
| InChIKey | XGMATGMWUVWQPG-DNVCBOLYSA-N |
| XLogP | 1.43 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |