About 1-[1-(5,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-1,4-diazepan-5-one
1-[1-(5,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-1,4-diazepan-5-one (PubChem CID 72926699) has the molecular formula C16H25N5O
and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[1-(5,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-[1-(5,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-1,4-diazepan-5-one |
| PubChem CID | 72926699 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 1-[1-(5,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-1,4-diazepan-5-one |
| SMILES | Cc1ncnc(N2CCC(N3CCNC(=O)CC3)CC2)c1C |
| InChI | InChI=1S/C16H25N5O/c1-12-13(2)18-11-19-16(12)21-7-3-14(4-8-21)20-9-5-15(22)17-6-10-20/h11,14H,3-10H2,1-2H3,(H,17,22) |
| InChIKey | NQYBVUXHOJZDSB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[1-(5,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(5,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-1,4-diazepan-5-one?
The IUPAC name of 1-[1-(5,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-1,4-diazepan-5-one (CID 72926699) is 1-[1-(5,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-1,4-diazepan-5-one.
What is the SMILES notation for 1-[1-(5,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-1,4-diazepan-5-one?
The canonical SMILES for 1-[1-(5,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-1,4-diazepan-5-one is Cc1ncnc(N2CCC(N3CCNC(=O)CC3)CC2)c1C.
What is the InChIKey of 1-[1-(5,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-1,4-diazepan-5-one?
The InChIKey is NQYBVUXHOJZDSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N5O/c1-12-13(2)18-11-19-16(12)21-7-3-14(4-8-21)20-9-5-15(22)17-6-10-20/h11,14H,3-10H2,1-2H3,(H,17,22).
What are the key properties of 1-[1-(5,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-1,4-diazepan-5-one?
1-[1-(5,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-1,4-diazepan-5-one has a molecular weight of 303.41 g/mol, XLogP of 0.88, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(5,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-1,4-diazepan-5-one is sourced from PubChem (CID 72926699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).