C13H21N7 — CID 72926789
4-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-5-ethylpyrimidine-2,4-diamine (PubChem CID 72926789) has the molecular formula C13H21N7 and a molecular weight of 275.36 g/mol. Its IUPAC name is 4-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-5-ethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-5-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 72926789 |
| Molecular Formula | C13H21N7 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 4-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-5-ethylpyrimidine-2,4-diamine |
| SMILES | CCc1cnc(N)nc1NCCCn1nc(C)nc1C |
| InChI | InChI=1S/C13H21N7/c1-4-11-8-16-13(14)18-12(11)15-6-5-7-20-10(3)17-9(2)19-20/h8H,4-7H2,1-3H3,(H3,14,15,16,18) |
| InChIKey | ASVSZDVLYAMNKF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|