C18H23N5OS — CID 72927530
4-[3-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]amino]propyl]-1,3-thiazol-2-amine (PubChem CID 72927530) has the molecular formula C18H23N5OS and a molecular weight of 357.48 g/mol. Its IUPAC name is 4-[3-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]amino]propyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[3-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]amino]propyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 72927530 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-[3-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]amino]propyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(CCCNC2CCN(c3nc4ccccc4o3)CC2)cs1 |
| InChI | InChI=1S/C18H23N5OS/c19-17-21-14(12-25-17)4-3-9-20-13-7-10-23(11-8-13)18-22-15-5-1-2-6-16(15)24-18/h1-2,5-6,12-13,20H,3-4,7-11H2,(H2,19,21) |
| InChIKey | RPHCSACJHVQTAC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|