C18H22N2O4S2 — CID 72927842
[(4aR,7aS)-1-[(5-methylfuran-2-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-methylthiophen-2-yl)methanone (PubChem CID 72927842) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is [(4aR,7aS)-1-[(5-methylfuran-2-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [(4aR,7aS)-1-[(5-methylfuran-2-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 72927842 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | [(4aR,7aS)-1-[(5-methylfuran-2-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccc(CN2CCN(C(=O)c3ccc(C)s3)[C@H]3CS(=O)(=O)C[C@H]32)o1 |
| InChI | InChI=1S/C18H22N2O4S2/c1-12-3-5-14(24-12)9-19-7-8-20(16-11-26(22,23)10-15(16)19)18(21)17-6-4-13(2)25-17/h3-6,15-16H,7-11H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | FMXFTMKOVCRINS-CVEARBPZSA-N |
| XLogP | 2.08 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |