C14H18FN5O3S — CID 72928625
N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2-fluoro-5-sulfamoylbenzamide (PubChem CID 72928625) has the molecular formula C14H18FN5O3S and a molecular weight of 355.40 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2-fluoro-5-sulfamoylbenzamide.
| Compound Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2-fluoro-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 72928625 |
| Molecular Formula | C14H18FN5O3S |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2-fluoro-5-sulfamoylbenzamide |
| SMILES | Cc1nc(C)n(CCCNC(=O)c2cc(S(N)(=O)=O)ccc2F)n1 |
| InChI | InChI=1S/C14H18FN5O3S/c1-9-18-10(2)20(19-9)7-3-6-17-14(21)12-8-11(24(16,22)23)4-5-13(12)15/h4-5,8H,3,6-7H2,1-2H3,(H,17,21)(H2,16,22,23) |
| InChIKey | VRTRRRNWQGLETE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|