About 2-Acetamidopyridine
2-Acetamidopyridine (PubChem CID 72929) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is N-pyridin-2-ylacetamide.
Molecular Properties
| Compound Name | 2-Acetamidopyridine |
| PubChem CID | 72929 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | N-pyridin-2-ylacetamide |
| SMILES | CC(=O)NC1=CC=CC=N1 |
| InChI | InChI=1S/C7H8N2O/c1-6(10)9-7-4-2-3-5-8-7/h2-5H,1H3,(H,8,9,10) |
| InChIKey | QROKOTBWFZITJZ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 42.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 125 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-Acetamidopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Acetamidopyridine?
The IUPAC name of 2-Acetamidopyridine (CID 72929) is N-pyridin-2-ylacetamide.
What is the SMILES notation for 2-Acetamidopyridine?
The canonical SMILES for 2-Acetamidopyridine is CC(=O)NC1=CC=CC=N1.
What is the InChIKey of 2-Acetamidopyridine?
The InChIKey is QROKOTBWFZITJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c1-6(10)9-7-4-2-3-5-8-7/h2-5H,1H3,(H,8,9,10).
What are the key properties of 2-Acetamidopyridine?
2-Acetamidopyridine has a molecular weight of 136.15 g/mol, XLogP of 0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Acetamidopyridine is sourced from PubChem (CID 72929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).