C19H29N5O2 — CID 72929751
1,10-dimethyl-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carbonyl)-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 72929751) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1,10-dimethyl-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carbonyl)-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | 1,10-dimethyl-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carbonyl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 72929751 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 1,10-dimethyl-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carbonyl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | CN1CCC2(CCC1=O)CN(C(=O)c1cnn3c1CCCC3)CCN2C |
| InChI | InChI=1S/C19H29N5O2/c1-21-10-8-19(7-6-17(21)25)14-23(12-11-22(19)2)18(26)15-13-20-24-9-4-3-5-16(15)24/h13H,3-12,14H2,1-2H3 |
| InChIKey | INPJNSIDIDSFNC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |