C11H15N5O2S3 — CID 72929890
2-methyl-5-methylsulfonyl-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]pyrimidin-4-amine (PubChem CID 72929890) has the molecular formula C11H15N5O2S3 and a molecular weight of 345.48 g/mol. Its IUPAC name is 2-methyl-5-methylsulfonyl-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]pyrimidin-4-amine.
| Compound Name | 2-methyl-5-methylsulfonyl-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 72929890 |
| Molecular Formula | C11H15N5O2S3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-methyl-5-methylsulfonyl-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]pyrimidin-4-amine |
| SMILES | Cc1ncc(S(C)(=O)=O)c(NCCSc2nnc(C)s2)n1 |
| InChI | InChI=1S/C11H15N5O2S3/c1-7-13-6-9(21(3,17)18)10(14-7)12-4-5-19-11-16-15-8(2)20-11/h6H,4-5H2,1-3H3,(H,12,13,14) |
| InChIKey | KHMIZXNMBCAMLJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|