C21H28N4O2 — CID 72930165
1-methyl-4-[2-(2-methyl-1H-indol-3-yl)acetyl]-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 72930165) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-methyl-4-[2-(2-methyl-1H-indol-3-yl)acetyl]-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | 1-methyl-4-[2-(2-methyl-1H-indol-3-yl)acetyl]-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 72930165 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 1-methyl-4-[2-(2-methyl-1H-indol-3-yl)acetyl]-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)N1CCN(C)C2(CCNC(=O)CC2)C1 |
| InChI | InChI=1S/C21H28N4O2/c1-15-17(16-5-3-4-6-18(16)23-15)13-20(27)25-12-11-24(2)21(14-25)8-7-19(26)22-10-9-21/h3-6,23H,7-14H2,1-2H3,(H,22,26) |
| InChIKey | WJXMCLFPKNLZIT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|