About 1-ethyl-1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)urea
1-ethyl-1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)urea (PubChem CID 72930844) has the molecular formula C17H21N7O2
and a molecular weight of 355.40 g/mol. Its IUPAC name is 1-ethyl-1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)urea.
Molecular Properties
| Compound Name | 1-ethyl-1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)urea |
| PubChem CID | 72930844 |
| Molecular Formula | C17H21N7O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 1-ethyl-1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)urea |
| SMILES | CCc1nnc(CN(CC)C(=O)Nc2cc(-c3ccccn3)nn2C)o1 |
| InChI | InChI=1S/C17H21N7O2/c1-4-15-20-21-16(26-15)11-24(5-2)17(25)19-14-10-13(22-23(14)3)12-8-6-7-9-18-12/h6-10H,4-5,11H2,1-3H3,(H,19,25) |
| InChIKey | IPKJXEIDVNMTHU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 101.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-ethyl-1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)urea?
The IUPAC name of 1-ethyl-1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)urea (CID 72930844) is 1-ethyl-1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)urea.
What is the SMILES notation for 1-ethyl-1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)urea?
The canonical SMILES for 1-ethyl-1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)urea is CCc1nnc(CN(CC)C(=O)Nc2cc(-c3ccccn3)nn2C)o1.
What is the InChIKey of 1-ethyl-1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)urea?
The InChIKey is IPKJXEIDVNMTHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N7O2/c1-4-15-20-21-16(26-15)11-24(5-2)17(25)19-14-10-13(22-23(14)3)12-8-6-7-9-18-12/h6-10H,4-5,11H2,1-3H3,(H,19,25).
What are the key properties of 1-ethyl-1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)urea?
1-ethyl-1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)urea has a molecular weight of 355.40 g/mol, XLogP of 2.48, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)urea is sourced from PubChem (CID 72930844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).