C18H22N4O3 — CID 72931273
2-[[2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]ethylamino]methyl]-6,8-dimethyl-1H-quinolin-4-one (PubChem CID 72931273) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[[2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]ethylamino]methyl]-6,8-dimethyl-1H-quinolin-4-one.
| Compound Name | 2-[[2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]ethylamino]methyl]-6,8-dimethyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 72931273 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-[[2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]ethylamino]methyl]-6,8-dimethyl-1H-quinolin-4-one |
| SMILES | COCc1noc(CCNCc2cc(=O)c3cc(C)cc(C)c3[nH]2)n1 |
| InChI | InChI=1S/C18H22N4O3/c1-11-6-12(2)18-14(7-11)15(23)8-13(20-18)9-19-5-4-17-21-16(10-24-3)22-25-17/h6-8,19H,4-5,9-10H2,1-3H3,(H,20,23) |
| InChIKey | YOSBSMFJGUMMHC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|