About 2-[4-[2-(2,4-dioxo-1H-pyrimidin-5-yl)acetyl]piperazin-1-yl]-N-ethylacetamide
2-[4-[2-(2,4-dioxo-1H-pyrimidin-5-yl)acetyl]piperazin-1-yl]-N-ethylacetamide (PubChem CID 72932140) has the molecular formula C14H21N5O4
and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-[4-[2-(2,4-dioxo-1H-pyrimidin-5-yl)acetyl]piperazin-1-yl]-N-ethylacetamide.
Molecular Properties
| Compound Name | 2-[4-[2-(2,4-dioxo-1H-pyrimidin-5-yl)acetyl]piperazin-1-yl]-N-ethylacetamide |
| PubChem CID | 72932140 |
| Molecular Formula | C14H21N5O4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-[4-[2-(2,4-dioxo-1H-pyrimidin-5-yl)acetyl]piperazin-1-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)CN1CCN(C(=O)Cc2c[nH]c(=O)[nH]c2=O)CC1 |
| InChI | InChI=1S/C14H21N5O4/c1-2-15-11(20)9-18-3-5-19(6-4-18)12(21)7-10-8-16-14(23)17-13(10)22/h8H,2-7,9H2,1H3,(H,15,20)(H2,16,17,22,23) |
| InChIKey | CBEQEAGRXOFKRM-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[2-(2,4-dioxo-1H-pyrimidin-5-yl)acetyl]piperazin-1-yl]-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(2,4-dioxo-1H-pyrimidin-5-yl)acetyl]piperazin-1-yl]-N-ethylacetamide?
The IUPAC name of 2-[4-[2-(2,4-dioxo-1H-pyrimidin-5-yl)acetyl]piperazin-1-yl]-N-ethylacetamide (CID 72932140) is 2-[4-[2-(2,4-dioxo-1H-pyrimidin-5-yl)acetyl]piperazin-1-yl]-N-ethylacetamide.
What is the SMILES notation for 2-[4-[2-(2,4-dioxo-1H-pyrimidin-5-yl)acetyl]piperazin-1-yl]-N-ethylacetamide?
The canonical SMILES for 2-[4-[2-(2,4-dioxo-1H-pyrimidin-5-yl)acetyl]piperazin-1-yl]-N-ethylacetamide is CCNC(=O)CN1CCN(C(=O)Cc2c[nH]c(=O)[nH]c2=O)CC1.
What is the InChIKey of 2-[4-[2-(2,4-dioxo-1H-pyrimidin-5-yl)acetyl]piperazin-1-yl]-N-ethylacetamide?
The InChIKey is CBEQEAGRXOFKRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5O4/c1-2-15-11(20)9-18-3-5-19(6-4-18)12(21)7-10-8-16-14(23)17-13(10)22/h8H,2-7,9H2,1H3,(H,15,20)(H2,16,17,22,23).
What are the key properties of 2-[4-[2-(2,4-dioxo-1H-pyrimidin-5-yl)acetyl]piperazin-1-yl]-N-ethylacetamide?
2-[4-[2-(2,4-dioxo-1H-pyrimidin-5-yl)acetyl]piperazin-1-yl]-N-ethylacetamide has a molecular weight of 323.35 g/mol, XLogP of -2.11, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(2,4-dioxo-1H-pyrimidin-5-yl)acetyl]piperazin-1-yl]-N-ethylacetamide is sourced from PubChem (CID 72932140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).