C10H16N6O2S — CID 72932662
N-methyl-N-[2-[4-(1-methylimidazol-2-yl)triazol-1-yl]ethyl]methanesulfonamide (PubChem CID 72932662) has the molecular formula C10H16N6O2S and a molecular weight of 284.35 g/mol. Its IUPAC name is N-methyl-N-[2-[4-(1-methylimidazol-2-yl)triazol-1-yl]ethyl]methanesulfonamide.
| Compound Name | N-methyl-N-[2-[4-(1-methylimidazol-2-yl)triazol-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 72932662 |
| Molecular Formula | C10H16N6O2S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-methyl-N-[2-[4-(1-methylimidazol-2-yl)triazol-1-yl]ethyl]methanesulfonamide |
| SMILES | CN(CCn1cc(-c2nccn2C)nn1)S(C)(=O)=O |
| InChI | InChI=1S/C10H16N6O2S/c1-14-5-4-11-10(14)9-8-16(13-12-9)7-6-15(2)19(3,17)18/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | XRTGHPCLDGMRAC-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 85.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |