About (4-ethoxy-3,5,6-trifluoro-2-pyridinyl)hydrazine
(4-ethoxy-3,5,6-trifluoro-2-pyridinyl)hydrazine (PubChem CID 729329) has the molecular formula C7H8F3N3O
and a molecular weight of 207.15 g/mol. Its IUPAC name is (4-ethoxy-3,5,6-trifluoro-2-pyridinyl)hydrazine.
Molecular Properties
| Compound Name | (4-ethoxy-3,5,6-trifluoro-2-pyridinyl)hydrazine |
| PubChem CID | 729329 |
| Molecular Formula | C7H8F3N3O |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | (4-ethoxy-3,5,6-trifluoro-2-pyridinyl)hydrazine |
| SMILES | CCOc1c(F)c(F)nc(NN)c1F |
| InChI | InChI=1S/C7H8F3N3O/c1-2-14-5-3(8)6(10)12-7(13-11)4(5)9/h2,11H2,1H3,(H,12,13) |
| InChIKey | HOQNIJUTZWFBNI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-ethoxy-3,5,6-trifluoro-2-pyridinyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxy-3,5,6-trifluoro-2-pyridinyl)hydrazine?
The IUPAC name of (4-ethoxy-3,5,6-trifluoro-2-pyridinyl)hydrazine (CID 729329) is (4-ethoxy-3,5,6-trifluoro-2-pyridinyl)hydrazine.
What is the SMILES notation for (4-ethoxy-3,5,6-trifluoro-2-pyridinyl)hydrazine?
The canonical SMILES for (4-ethoxy-3,5,6-trifluoro-2-pyridinyl)hydrazine is CCOc1c(F)c(F)nc(NN)c1F.
What is the InChIKey of (4-ethoxy-3,5,6-trifluoro-2-pyridinyl)hydrazine?
The InChIKey is HOQNIJUTZWFBNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N3O/c1-2-14-5-3(8)6(10)12-7(13-11)4(5)9/h2,11H2,1H3,(H,12,13).
What are the key properties of (4-ethoxy-3,5,6-trifluoro-2-pyridinyl)hydrazine?
(4-ethoxy-3,5,6-trifluoro-2-pyridinyl)hydrazine has a molecular weight of 207.15 g/mol, XLogP of 1.18, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxy-3,5,6-trifluoro-2-pyridinyl)hydrazine is sourced from PubChem (CID 729329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).