About (4S)-4-(methoxymethyl)-3,3-dimethyl-1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-ol
(4S)-4-(methoxymethyl)-3,3-dimethyl-1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-ol (PubChem CID 72933005) has the molecular formula C17H28N4O3
and a molecular weight of 336.44 g/mol. Its IUPAC name is (4S)-4-(methoxymethyl)-3,3-dimethyl-1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-ol.
Molecular Properties
| Compound Name | (4S)-4-(methoxymethyl)-3,3-dimethyl-1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-ol |
| PubChem CID | 72933005 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (4S)-4-(methoxymethyl)-3,3-dimethyl-1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-ol |
| SMILES | COC[C@]1(O)CCN(c2cc(N3CCOCC3)ncn2)CC1(C)C |
| InChI | InChI=1S/C17H28N4O3/c1-16(2)11-21(5-4-17(16,22)12-23-3)15-10-14(18-13-19-15)20-6-8-24-9-7-20/h10,13,22H,4-9,11-12H2,1-3H3/t17-/m1/s1 |
| InChIKey | CWZVOAKVYWJOQX-QGZVFWFLSA-N |
| XLogP | 0.93 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (4S)-4-(methoxymethyl)-3,3-dimethyl-1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(methoxymethyl)-3,3-dimethyl-1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-ol?
The IUPAC name of (4S)-4-(methoxymethyl)-3,3-dimethyl-1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-ol (CID 72933005) is (4S)-4-(methoxymethyl)-3,3-dimethyl-1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-ol.
What is the SMILES notation for (4S)-4-(methoxymethyl)-3,3-dimethyl-1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-ol?
The canonical SMILES for (4S)-4-(methoxymethyl)-3,3-dimethyl-1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-ol is COC[C@]1(O)CCN(c2cc(N3CCOCC3)ncn2)CC1(C)C.
What is the InChIKey of (4S)-4-(methoxymethyl)-3,3-dimethyl-1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-ol?
The InChIKey is CWZVOAKVYWJOQX-QGZVFWFLSA-N. The full InChI is InChI=1S/C17H28N4O3/c1-16(2)11-21(5-4-17(16,22)12-23-3)15-10-14(18-13-19-15)20-6-8-24-9-7-20/h10,13,22H,4-9,11-12H2,1-3H3/t17-/m1/s1.
What are the key properties of (4S)-4-(methoxymethyl)-3,3-dimethyl-1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-ol?
(4S)-4-(methoxymethyl)-3,3-dimethyl-1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-ol has a molecular weight of 336.44 g/mol, XLogP of 0.93, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(methoxymethyl)-3,3-dimethyl-1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-ol is sourced from PubChem (CID 72933005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).