About 6-morpholin-4-yl-1H-1,3,5-triazin-2-one
6-morpholin-4-yl-1H-1,3,5-triazin-2-one (PubChem CID 729336) has the molecular formula C7H10N4O2
and a molecular weight of 182.18 g/mol. Its IUPAC name is 6-morpholin-4-yl-1H-1,3,5-triazin-2-one.
Molecular Properties
| Compound Name | 6-morpholin-4-yl-1H-1,3,5-triazin-2-one |
| PubChem CID | 729336 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 6-morpholin-4-yl-1H-1,3,5-triazin-2-one |
| SMILES | O=c1ncnc(N2CCOCC2)[nH]1 |
| InChI | InChI=1S/C7H10N4O2/c12-7-9-5-8-6(10-7)11-1-3-13-4-2-11/h5H,1-4H2,(H,8,9,10,12) |
| InChIKey | ZMHCDXJDNHAFPS-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-morpholin-4-yl-1H-1,3,5-triazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-morpholin-4-yl-1H-1,3,5-triazin-2-one?
The IUPAC name of 6-morpholin-4-yl-1H-1,3,5-triazin-2-one (CID 729336) is 6-morpholin-4-yl-1H-1,3,5-triazin-2-one.
What is the SMILES notation for 6-morpholin-4-yl-1H-1,3,5-triazin-2-one?
The canonical SMILES for 6-morpholin-4-yl-1H-1,3,5-triazin-2-one is O=c1ncnc(N2CCOCC2)[nH]1.
What is the InChIKey of 6-morpholin-4-yl-1H-1,3,5-triazin-2-one?
The InChIKey is ZMHCDXJDNHAFPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2/c12-7-9-5-8-6(10-7)11-1-3-13-4-2-11/h5H,1-4H2,(H,8,9,10,12).
What are the key properties of 6-morpholin-4-yl-1H-1,3,5-triazin-2-one?
6-morpholin-4-yl-1H-1,3,5-triazin-2-one has a molecular weight of 182.18 g/mol, XLogP of -1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-morpholin-4-yl-1H-1,3,5-triazin-2-one is sourced from PubChem (CID 729336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).