C24H31N3O — CID 72933715
4-[(2-methyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl)methyl]benzamide (PubChem CID 72933715) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 4-[(2-methyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl)methyl]benzamide.
| Compound Name | 4-[(2-methyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl)methyl]benzamide |
|---|---|
| PubChem CID | 72933715 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 4-[(2-methyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl)methyl]benzamide |
| SMILES | CN1CC(c2ccccc2)CC2(CCN(Cc3ccc(C(N)=O)cc3)CC2)C1 |
| InChI | InChI=1S/C24H31N3O/c1-26-17-22(20-5-3-2-4-6-20)15-24(18-26)11-13-27(14-12-24)16-19-7-9-21(10-8-19)23(25)28/h2-10,22H,11-18H2,1H3,(H2,25,28) |
| InChIKey | PCHDNJIYHJBNKZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |