C20H33N3O3 — CID 72933840
1-[2-(3-methylbutyl)-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl]-2-pyrrolidin-1-ylethane-1,2-dione (PubChem CID 72933840) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-[2-(3-methylbutyl)-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl]-2-pyrrolidin-1-ylethane-1,2-dione.
| Compound Name | 1-[2-(3-methylbutyl)-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl]-2-pyrrolidin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 72933840 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | 1-[2-(3-methylbutyl)-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl]-2-pyrrolidin-1-ylethane-1,2-dione |
| SMILES | CC(C)CCN1CC2(CCCN(C(=O)C(=O)N3CCCC3)C2)CCC1=O |
| InChI | InChI=1S/C20H33N3O3/c1-16(2)7-13-22-14-20(9-6-17(22)24)8-5-12-23(15-20)19(26)18(25)21-10-3-4-11-21/h16H,3-15H2,1-2H3 |
| InChIKey | JBORHMSVXLTIPV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|