C12H17N3O4 — CID 72933861
1,3-dimethyl-N-(oxan-4-yl)-2,6-dioxopyrimidine-4-carboxamide (PubChem CID 72933861) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 1,3-dimethyl-N-(oxan-4-yl)-2,6-dioxopyrimidine-4-carboxamide.
| Compound Name | 1,3-dimethyl-N-(oxan-4-yl)-2,6-dioxopyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 72933861 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1,3-dimethyl-N-(oxan-4-yl)-2,6-dioxopyrimidine-4-carboxamide |
| SMILES | Cn1c(C(=O)NC2CCOCC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C12H17N3O4/c1-14-9(7-10(16)15(2)12(14)18)11(17)13-8-3-5-19-6-4-8/h7-8H,3-6H2,1-2H3,(H,13,17) |
| InChIKey | QOBPBZXDMFKVKD-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |