About 1-[2-[3-(2-amino-1,3-thiazol-4-yl)propylamino]-4-methylpyrimidin-5-yl]ethanone
1-[2-[3-(2-amino-1,3-thiazol-4-yl)propylamino]-4-methylpyrimidin-5-yl]ethanone (PubChem CID 72933882) has the molecular formula C13H17N5OS
and a molecular weight of 291.38 g/mol. Its IUPAC name is 1-[2-[3-(2-amino-1,3-thiazol-4-yl)propylamino]-4-methylpyrimidin-5-yl]ethanone.
Molecular Properties
| Compound Name | 1-[2-[3-(2-amino-1,3-thiazol-4-yl)propylamino]-4-methylpyrimidin-5-yl]ethanone |
| PubChem CID | 72933882 |
| Molecular Formula | C13H17N5OS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 1-[2-[3-(2-amino-1,3-thiazol-4-yl)propylamino]-4-methylpyrimidin-5-yl]ethanone |
| SMILES | CC(=O)c1cnc(NCCCc2csc(N)n2)nc1C |
| InChI | InChI=1S/C13H17N5OS/c1-8-11(9(2)19)6-16-13(17-8)15-5-3-4-10-7-20-12(14)18-10/h6-7H,3-5H2,1-2H3,(H2,14,18)(H,15,16,17) |
| InChIKey | NCEUSJLCTQZEFE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[3-(2-amino-1,3-thiazol-4-yl)propylamino]-4-methylpyrimidin-5-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[3-(2-amino-1,3-thiazol-4-yl)propylamino]-4-methylpyrimidin-5-yl]ethanone?
The IUPAC name of 1-[2-[3-(2-amino-1,3-thiazol-4-yl)propylamino]-4-methylpyrimidin-5-yl]ethanone (CID 72933882) is 1-[2-[3-(2-amino-1,3-thiazol-4-yl)propylamino]-4-methylpyrimidin-5-yl]ethanone.
What is the SMILES notation for 1-[2-[3-(2-amino-1,3-thiazol-4-yl)propylamino]-4-methylpyrimidin-5-yl]ethanone?
The canonical SMILES for 1-[2-[3-(2-amino-1,3-thiazol-4-yl)propylamino]-4-methylpyrimidin-5-yl]ethanone is CC(=O)c1cnc(NCCCc2csc(N)n2)nc1C.
What is the InChIKey of 1-[2-[3-(2-amino-1,3-thiazol-4-yl)propylamino]-4-methylpyrimidin-5-yl]ethanone?
The InChIKey is NCEUSJLCTQZEFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5OS/c1-8-11(9(2)19)6-16-13(17-8)15-5-3-4-10-7-20-12(14)18-10/h6-7H,3-5H2,1-2H3,(H2,14,18)(H,15,16,17).
What are the key properties of 1-[2-[3-(2-amino-1,3-thiazol-4-yl)propylamino]-4-methylpyrimidin-5-yl]ethanone?
1-[2-[3-(2-amino-1,3-thiazol-4-yl)propylamino]-4-methylpyrimidin-5-yl]ethanone has a molecular weight of 291.38 g/mol, XLogP of 2.07, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[3-(2-amino-1,3-thiazol-4-yl)propylamino]-4-methylpyrimidin-5-yl]ethanone is sourced from PubChem (CID 72933882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).