C21H28N4O2 — CID 72934305
5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-(1-adamantyl)-1H-pyrimidin-6-one (PubChem CID 72934305) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-(1-adamantyl)-1H-pyrimidin-6-one.
| Compound Name | 5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-(1-adamantyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 72934305 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-(1-adamantyl)-1H-pyrimidin-6-one |
| SMILES | O=C(c1cnc(C23CC4CC(CC(C4)C2)C3)[nH]c1=O)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C21H28N4O2/c26-18-17(19(27)25-10-15-7-22-8-16(15)11-25)9-23-20(24-18)21-4-12-1-13(5-21)3-14(2-12)6-21/h9,12-16,22H,1-8,10-11H2,(H,23,24,26)/t12?,13?,14?,15-,16+,21? |
| InChIKey | FYENCJCLLHFEFQ-AWPDPCMLSA-N |
| XLogP | 1.53 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |