C17H22F3NO3 — CID 72934356
[(3aS,9bS)-7-methoxy-2-(4,4,4-trifluorobutyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 72934356) has the molecular formula C17H22F3NO3 and a molecular weight of 345.36 g/mol. Its IUPAC name is [(3aS,9bS)-7-methoxy-2-(4,4,4-trifluorobutyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aS,9bS)-7-methoxy-2-(4,4,4-trifluorobutyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 72934356 |
| Molecular Formula | C17H22F3NO3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [(3aS,9bS)-7-methoxy-2-(4,4,4-trifluorobutyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | COc1ccc2c(c1)OC[C@]1(CO)CN(CCCC(F)(F)F)C[C@H]21 |
| InChI | InChI=1S/C17H22F3NO3/c1-23-12-3-4-13-14-8-21(6-2-5-17(18,19)20)9-16(14,10-22)11-24-15(13)7-12/h3-4,7,14,22H,2,5-6,8-11H2,1H3/t14-,16-/m1/s1 |
| InChIKey | DQBWTPVYFQOULJ-GDBMZVCRSA-N |
| XLogP | 2.81 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |