C16H20N4O2 — CID 72934573
4-[1-[2-(1,2,4-triazol-4-yl)ethyl]piperidin-3-yl]benzoic acid (PubChem CID 72934573) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-[1-[2-(1,2,4-triazol-4-yl)ethyl]piperidin-3-yl]benzoic acid.
| Compound Name | 4-[1-[2-(1,2,4-triazol-4-yl)ethyl]piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 72934573 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 4-[1-[2-(1,2,4-triazol-4-yl)ethyl]piperidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(C2CCCN(CCn3cnnc3)C2)cc1 |
| InChI | InChI=1S/C16H20N4O2/c21-16(22)14-5-3-13(4-6-14)15-2-1-7-19(10-15)8-9-20-11-17-18-12-20/h3-6,11-12,15H,1-2,7-10H2,(H,21,22) |
| InChIKey | UCJPJKBNMAVYPW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |