C20H32FN3O — CID 72934848
N-[1-(azepan-1-yl)-2-methylpropan-2-yl]-2-(dimethylamino)-2-(2-fluorophenyl)acetamide (PubChem CID 72934848) has the molecular formula C20H32FN3O and a molecular weight of 349.49 g/mol. Its IUPAC name is N-[1-(azepan-1-yl)-2-methylpropan-2-yl]-2-(dimethylamino)-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[1-(azepan-1-yl)-2-methylpropan-2-yl]-2-(dimethylamino)-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 72934848 |
| Molecular Formula | C20H32FN3O |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | N-[1-(azepan-1-yl)-2-methylpropan-2-yl]-2-(dimethylamino)-2-(2-fluorophenyl)acetamide |
| SMILES | CN(C)C(C(=O)NC(C)(C)CN1CCCCCC1)c1ccccc1F |
| InChI | InChI=1S/C20H32FN3O/c1-20(2,15-24-13-9-5-6-10-14-24)22-19(25)18(23(3)4)16-11-7-8-12-17(16)21/h7-8,11-12,18H,5-6,9-10,13-15H2,1-4H3,(H,22,25) |
| InChIKey | LIXBUTOVJQVEPQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |